C16H15BrO6S — CID 90643240
3-bromo-5-ethoxy-4-(4-methylphenyl)sulfonyloxybenzoic acid (PubChem CID 90643240) has the molecular formula C16H15BrO6S and a molecular weight of 415.26 g/mol. Its IUPAC name is 3-bromo-5-ethoxy-4-(4-methylphenyl)sulfonyloxybenzoic acid.
| Compound Name | 3-bromo-5-ethoxy-4-(4-methylphenyl)sulfonyloxybenzoic acid |
|---|---|
| PubChem CID | 90643240 |
| Molecular Formula | C16H15BrO6S |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 3-bromo-5-ethoxy-4-(4-methylphenyl)sulfonyloxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)cc(Br)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H15BrO6S/c1-3-22-14-9-11(16(18)19)8-13(17)15(14)23-24(20,21)12-6-4-10(2)5-7-12/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | MVEIENLUVPTKKW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|