C23H22BrNO5S — CID 126205142
[2-bromo-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126205142) has the molecular formula C23H22BrNO5S and a molecular weight of 504.40 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126205142 |
| Molecular Formula | C23H22BrNO5S |
| Molecular Weight | 504.40 g/mol |
| Exact Mass | 503.04 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(4-methoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(/C=N/c2ccc(OC)cc2)cc(Br)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H22BrNO5S/c1-4-29-22-14-17(15-25-18-7-9-19(28-3)10-8-18)13-21(24)23(22)30-31(26,27)20-11-5-16(2)6-12-20/h5-15H,4H2,1-3H3/b25-15+ |
| InChIKey | AFSMQQJTVOTBPJ-MFKUBSTISA-N |
| XLogP | 5.68 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|