C21H17BrN2O6S — CID 126074730
[2-bromo-6-ethoxy-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate (PubChem CID 126074730) has the molecular formula C21H17BrN2O6S and a molecular weight of 505.35 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate.
| Compound Name | [2-bromo-6-ethoxy-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126074730 |
| Molecular Formula | C21H17BrN2O6S |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 504.00 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(4-nitrophenyl)iminomethyl]phenyl] benzenesulfonate |
| SMILES | CCOc1cc(/C=N/c2ccc([N+](=O)[O-])cc2)cc(Br)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17BrN2O6S/c1-2-29-20-13-15(14-23-16-8-10-17(11-9-16)24(25)26)12-19(22)21(20)30-31(27,28)18-6-4-3-5-7-18/h3-14H,2H2,1H3/b23-14+ |
| InChIKey | QZBKSINQKXCQKO-OEAKJJBVSA-N |
| XLogP | 5.27 |
| TPSA | 108.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|