C23H22BrNO4S — CID 126220047
[2-bromo-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] benzenesulfonate (PubChem CID 126220047) has the molecular formula C23H22BrNO4S and a molecular weight of 488.40 g/mol. Its IUPAC name is [2-bromo-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] benzenesulfonate.
| Compound Name | [2-bromo-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126220047 |
| Molecular Formula | C23H22BrNO4S |
| Molecular Weight | 488.40 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | [2-bromo-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] benzenesulfonate |
| SMILES | CCOc1cc(/C=N/c2cccc(C)c2C)cc(Br)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H22BrNO4S/c1-4-28-22-14-18(15-25-21-12-8-9-16(2)17(21)3)13-20(24)23(22)29-30(26,27)19-10-6-5-7-11-19/h5-15H,4H2,1-3H3/b25-15+ |
| InChIKey | UATDUUOAYFSXRC-MFKUBSTISA-N |
| XLogP | 5.98 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.40 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|