C24H24ClNO4S — CID 126214035
[2-chloro-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 126214035) has the molecular formula C24H24ClNO4S and a molecular weight of 457.98 g/mol. Its IUPAC name is [2-chloro-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-chloro-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126214035 |
| Molecular Formula | C24H24ClNO4S |
| Molecular Weight | 457.98 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | [2-chloro-4-[(2,3-dimethylphenyl)iminomethyl]-6-ethoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(/C=N/c2cccc(C)c2C)cc(Cl)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H24ClNO4S/c1-5-29-23-14-19(15-26-22-8-6-7-17(3)18(22)4)13-21(25)24(23)30-31(27,28)20-11-9-16(2)10-12-20/h6-15H,5H2,1-4H3/b26-15+ |
| InChIKey | APHALEXRCCRXAV-CVKSISIWSA-N |
| XLogP | 6.18 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.98 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|