C22H21NO3S — CID 126207241
[4-[(2,3-dimethylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126207241) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is [4-[(2,3-dimethylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[(2,3-dimethylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126207241 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [4-[(2,3-dimethylphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=N/c3cccc(C)c3C)cc2)cc1 |
| InChI | InChI=1S/C22H21NO3S/c1-16-7-13-21(14-8-16)27(24,25)26-20-11-9-19(10-12-20)15-23-22-6-4-5-17(2)18(22)3/h4-15H,1-3H3/b23-15+ |
| InChIKey | LIFQEDUSWOSHFO-HZHRSRAPSA-N |
| XLogP | 5.13 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|