C18H17NO — CID 126207356
N-(2,3-dimethylphenyl)-1-(4-prop-2-ynoxyphenyl)methanimine (PubChem CID 126207356) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-(4-prop-2-ynoxyphenyl)methanimine.
| Compound Name | N-(2,3-dimethylphenyl)-1-(4-prop-2-ynoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126207356 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-(4-prop-2-ynoxyphenyl)methanimine |
| SMILES | C#CCOc1ccc(/C=N/c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C18H17NO/c1-4-12-20-17-10-8-16(9-11-17)13-19-18-7-5-6-14(2)15(18)3/h1,5-11,13H,12H2,2-3H3/b19-13+ |
| InChIKey | LXRXGHVZNBFNMI-CPNJWEJPSA-N |
| XLogP | 4.07 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|