C18H16INO2 — CID 126217700
1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)-N-(2-methylphenyl)methanimine (PubChem CID 126217700) has the molecular formula C18H16INO2 and a molecular weight of 405.24 g/mol. Its IUPAC name is 1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)-N-(2-methylphenyl)methanimine.
| Compound Name | 1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)-N-(2-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126217700 |
| Molecular Formula | C18H16INO2 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 1-(3-iodo-5-methoxy-4-prop-2-ynoxyphenyl)-N-(2-methylphenyl)methanimine |
| SMILES | C#CCOc1c(I)cc(/C=N/c2ccccc2C)cc1OC |
| InChI | InChI=1S/C18H16INO2/c1-4-9-22-18-15(19)10-14(11-17(18)21-3)12-20-16-8-6-5-7-13(16)2/h1,5-8,10-12H,9H2,2-3H3/b20-12+ |
| InChIKey | NWITZBNBEWOWDS-UDWIEESQSA-N |
| XLogP | 4.37 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|