C20H21IN2O3 — CID 29148451
N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine (PubChem CID 29148451) has the molecular formula C20H21IN2O3 and a molecular weight of 464.30 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine.
| Compound Name | N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 29148451 |
| Molecular Formula | C20H21IN2O3 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-[(Z)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-1-(2-methoxyphenyl)methanamine |
| SMILES | C#CCOc1c(I)cc(/C=N\NCc2ccccc2OC)cc1OCC |
| InChI | InChI=1S/C20H21IN2O3/c1-4-10-26-20-17(21)11-15(12-19(20)25-5-2)13-22-23-14-16-8-6-7-9-18(16)24-3/h1,6-9,11-13,23H,5,10,14H2,2-3H3/b22-13- |
| InChIKey | DOTQPVAWILYBKU-XKZIYDEJSA-N |
| XLogP | 3.83 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|