C20H18IN3O5 — CID 126377549
N-[(E)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide (PubChem CID 126377549) has the molecular formula C20H18IN3O5 and a molecular weight of 507.28 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(E)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 126377549 |
| Molecular Formula | C20H18IN3O5 |
| Molecular Weight | 507.28 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | N-[(E)-(3-ethoxy-5-iodo-4-prop-2-ynoxyphenyl)methylideneamino]-2-(2-nitrophenyl)acetamide |
| SMILES | C#CCOc1c(I)cc(/C=N/NC(=O)Cc2ccccc2[N+](=O)[O-])cc1OCC |
| InChI | InChI=1S/C20H18IN3O5/c1-3-9-29-20-16(21)10-14(11-18(20)28-4-2)13-22-23-19(25)12-15-7-5-6-8-17(15)24(26)27/h1,5-8,10-11,13H,4,9,12H2,2H3,(H,23,25)/b22-13+ |
| InChIKey | NZYFLGXQIKMKOM-LPYMAVHISA-N |
| XLogP | 3.30 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|