C20H20IN3O7 — CID 126375860
methyl 2-[2-ethoxy-6-iodo-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 126375860) has the molecular formula C20H20IN3O7 and a molecular weight of 541.30 g/mol. Its IUPAC name is methyl 2-[2-ethoxy-6-iodo-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-ethoxy-6-iodo-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126375860 |
| Molecular Formula | C20H20IN3O7 |
| Molecular Weight | 541.30 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | methyl 2-[2-ethoxy-6-iodo-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccccc2[N+](=O)[O-])cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C20H20IN3O7/c1-3-30-17-9-13(8-15(21)20(17)31-12-19(26)29-2)11-22-23-18(25)10-14-6-4-5-7-16(14)24(27)28/h4-9,11H,3,10,12H2,1-2H3,(H,23,25)/b22-11+ |
| InChIKey | FESMIMXNEGBTRQ-SSDVNMTOSA-N |
| XLogP | 2.84 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|