C19H18BrN3O7 — CID 5200719
2-[2-bromo-6-ethoxy-4-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 5200719) has the molecular formula C19H18BrN3O7 and a molecular weight of 480.27 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 5200719 |
| Molecular Formula | C19H18BrN3O7 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 479.03 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(C=NNC(=O)Cc2ccccc2[N+](=O)[O-])cc(Br)c1OCC(=O)O |
| InChI | InChI=1S/C19H18BrN3O7/c1-2-29-16-8-12(7-14(20)19(16)30-11-18(25)26)10-21-22-17(24)9-13-5-3-4-6-15(13)23(27)28/h3-8,10H,2,9,11H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | AZYAKXGMNQEJLR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|