C25H22BrN3O7 — CID 126378037
3-[[2-bromo-6-ethoxy-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid (PubChem CID 126378037) has the molecular formula C25H22BrN3O7 and a molecular weight of 556.37 g/mol. Its IUPAC name is 3-[[2-bromo-6-ethoxy-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-bromo-6-ethoxy-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126378037 |
| Molecular Formula | C25H22BrN3O7 |
| Molecular Weight | 556.37 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | 3-[[2-bromo-6-ethoxy-4-[(E)-[[2-(2-nitrophenyl)acetyl]hydrazinylidene]methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=N/NC(=O)Cc2ccccc2[N+](=O)[O-])cc(Br)c1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H22BrN3O7/c1-2-35-22-12-17(14-27-28-23(30)13-18-7-3-4-9-21(18)29(33)34)11-20(26)24(22)36-15-16-6-5-8-19(10-16)25(31)32/h3-12,14H,2,13,15H2,1H3,(H,28,30)(H,31,32)/b27-14+ |
| InChIKey | SJROZVMFJJNHNM-MZJWZYIUSA-N |
| XLogP | 4.73 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|