C24H23BrN4O5 — CID 126389668
2-anilino-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 126389668) has the molecular formula C24H23BrN4O5 and a molecular weight of 527.38 g/mol. Its IUPAC name is 2-anilino-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-anilino-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126389668 |
| Molecular Formula | C24H23BrN4O5 |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | 2-anilino-N-[(Z)-[3-bromo-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNc2ccccc2)cc(Br)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H23BrN4O5/c1-2-33-22-13-18(14-27-28-23(30)15-26-19-6-4-3-5-7-19)12-21(25)24(22)34-16-17-8-10-20(11-9-17)29(31)32/h3-14,26H,2,15-16H2,1H3,(H,28,30)/b27-14- |
| InChIKey | HMJWLLQDNXJGMQ-VYYCAZPPSA-N |
| XLogP | 4.90 |
| TPSA | 115.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|