C19H21BrIN3O3 — CID 126274682
N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide (PubChem CID 126274682) has the molecular formula C19H21BrIN3O3 and a molecular weight of 546.20 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide.
| Compound Name | N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide |
|---|---|
| PubChem CID | 126274682 |
| Molecular Formula | C19H21BrIN3O3 |
| Molecular Weight | 546.20 g/mol |
| Exact Mass | 544.98 |
| IUPAC Name | N-[(Z)-(3-bromo-4,5-diethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNc2ccc(I)cc2)cc(Br)c1OCC |
| InChI | InChI=1S/C19H21BrIN3O3/c1-3-26-17-10-13(9-16(20)19(17)27-4-2)11-23-24-18(25)12-22-15-7-5-14(21)6-8-15/h5-11,22H,3-4,12H2,1-2H3,(H,24,25)/b23-11- |
| InChIKey | UXCSWBUPHVDCPX-KSEXSDGBSA-N |
| XLogP | 4.41 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|