C24H24IN3O3 — CID 126257098
N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide (PubChem CID 126257098) has the molecular formula C24H24IN3O3 and a molecular weight of 529.38 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide |
|---|---|
| PubChem CID | 126257098 |
| Molecular Formula | C24H24IN3O3 |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]-2-(4-iodoanilino)acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CNc2ccc(I)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H24IN3O3/c1-2-30-23-14-19(8-13-22(23)31-17-18-6-4-3-5-7-18)15-27-28-24(29)16-26-21-11-9-20(25)10-12-21/h3-15,26H,2,16-17H2,1H3,(H,28,29)/b27-15- |
| InChIKey | NLNINIGDAKKPDG-DICXZTSXSA-N |
| XLogP | 4.83 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|