C23H21Br2N3O3 — CID 126370173
2-(4-bromoanilino)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide (PubChem CID 126370173) has the molecular formula C23H21Br2N3O3 and a molecular weight of 547.25 g/mol. Its IUPAC name is 2-(4-bromoanilino)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide.
| Compound Name | 2-(4-bromoanilino)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126370173 |
| Molecular Formula | C23H21Br2N3O3 |
| Molecular Weight | 547.25 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | 2-(4-bromoanilino)-N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]acetamide |
| SMILES | COc1cc(/C=N\NC(=O)CNc2ccc(Br)cc2)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H21Br2N3O3/c1-30-22-12-17(4-11-21(22)31-15-16-2-5-18(24)6-3-16)13-27-28-23(29)14-26-20-9-7-19(25)8-10-20/h2-13,26H,14-15H2,1H3,(H,28,29)/b27-13- |
| InChIKey | ZLLVKRPUXTYRCL-WKIKZPBSSA-N |
| XLogP | 5.36 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.25 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|