C25H25BrN2O3 — CID 133145339
N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide (PubChem CID 133145339) has the molecular formula C25H25BrN2O3 and a molecular weight of 481.39 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 133145339 |
| Molecular Formula | C25H25BrN2O3 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[(Z)-[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-2-(2,4-dimethylphenyl)acetamide |
| SMILES | COc1cc(/C=N\NC(=O)Cc2ccc(C)cc2C)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C25H25BrN2O3/c1-17-4-8-21(18(2)12-17)14-25(29)28-27-15-20-7-11-23(24(13-20)30-3)31-16-19-5-9-22(26)10-6-19/h4-13,15H,14,16H2,1-3H3,(H,28,29)/b27-15- |
| InChIKey | LUDZNQGHUZMHMF-DICXZTSXSA-N |
| XLogP | 5.35 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|