C23H22N2O3 — CID 6117131
N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 6117131) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6117131 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | CC(=O)N/N=C\c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C23H22N2O3/c1-18(26)25-24-15-21-12-13-22(27-16-19-8-4-2-5-9-19)23(14-21)28-17-20-10-6-3-7-11-20/h2-15H,16-17H2,1H3,(H,25,26)/b24-15- |
| InChIKey | YPJIRHWSFHRARR-IWIPYMOSSA-N |
| XLogP | 4.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|