C26H22N2O4 — CID 2336578
N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]furan-2-carboxamide (PubChem CID 2336578) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 2336578 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]furan-2-carboxamide |
| SMILES | O=C(NN=Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1)c1ccco1 |
| InChI | InChI=1S/C26H22N2O4/c29-26(24-12-7-15-30-24)28-27-17-22-13-14-23(31-18-20-8-3-1-4-9-20)25(16-22)32-19-21-10-5-2-6-11-21/h1-17H,18-19H2,(H,28,29) |
| InChIKey | YPQSXPUADVDZBN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|