C22H21N3O3 — CID 1267665
[[3,4-bis(phenylmethoxy)phenyl]methylideneamino]urea (PubChem CID 1267665) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is [[3,4-bis(phenylmethoxy)phenyl]methylideneamino]urea.
| Compound Name | [[3,4-bis(phenylmethoxy)phenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 1267665 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | [[3,4-bis(phenylmethoxy)phenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C22H21N3O3/c23-22(26)25-24-14-19-11-12-20(27-15-17-7-3-1-4-8-17)21(13-19)28-16-18-9-5-2-6-10-18/h1-14H,15-16H2,(H3,23,25,26) |
| InChIKey | HJVBSPGEBHBIQS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|