C15H16BN3O4 — CID 168534084
[5-[(carbamoylhydrazinylidene)methyl]-2-phenylmethoxyphenyl]boronic acid (PubChem CID 168534084) has the molecular formula C15H16BN3O4 and a molecular weight of 313.12 g/mol. Its IUPAC name is [5-[(carbamoylhydrazinylidene)methyl]-2-phenylmethoxyphenyl]boronic acid.
| Compound Name | [5-[(carbamoylhydrazinylidene)methyl]-2-phenylmethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168534084 |
| Molecular Formula | C15H16BN3O4 |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [5-[(carbamoylhydrazinylidene)methyl]-2-phenylmethoxyphenyl]boronic acid |
| SMILES | NC(=O)NN=Cc1ccc(OCc2ccccc2)c(B(O)O)c1 |
| InChI | InChI=1S/C15H16BN3O4/c17-15(20)19-18-9-12-6-7-14(13(8-12)16(21)22)23-10-11-4-2-1-3-5-11/h1-9,21-22H,10H2,(H3,17,19,20) |
| InChIKey | KHJHMZGPBXDNNM-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|