C15H12F3N3O2 — CID 168532203
[[4-[(3,4-difluorophenyl)methoxy]-3-fluorophenyl]methylideneamino]urea (PubChem CID 168532203) has the molecular formula C15H12F3N3O2 and a molecular weight of 323.27 g/mol. Its IUPAC name is [[4-[(3,4-difluorophenyl)methoxy]-3-fluorophenyl]methylideneamino]urea.
| Compound Name | [[4-[(3,4-difluorophenyl)methoxy]-3-fluorophenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 168532203 |
| Molecular Formula | C15H12F3N3O2 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [[4-[(3,4-difluorophenyl)methoxy]-3-fluorophenyl]methylideneamino]urea |
| SMILES | NC(=O)NN=Cc1ccc(OCc2ccc(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C15H12F3N3O2/c16-11-3-1-10(6-12(11)17)8-23-14-4-2-9(5-13(14)18)7-20-21-15(19)22/h1-7H,8H2,(H3,19,21,22) |
| InChIKey | RUYUXWFAKHFIGS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|