C22H22BN3O3S — CID 168613840
[5-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-phenylmethoxyphenyl]boronic acid (PubChem CID 168613840) has the molecular formula C22H22BN3O3S and a molecular weight of 419.32 g/mol. Its IUPAC name is [5-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-phenylmethoxyphenyl]boronic acid.
| Compound Name | [5-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-phenylmethoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 168613840 |
| Molecular Formula | C22H22BN3O3S |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | [5-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-phenylmethoxyphenyl]boronic acid |
| SMILES | NC(=NN=Cc1ccc(OCc2ccccc2)c(B(O)O)c1)SCc1ccccc1 |
| InChI | InChI=1S/C22H22BN3O3S/c24-22(30-16-18-9-5-2-6-10-18)26-25-14-19-11-12-21(20(13-19)23(27)28)29-15-17-7-3-1-4-8-17/h1-14,27-28H,15-16H2,(H2,24,26) |
| InChIKey | AYPYUTDPRRFGIJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|