C23H23N3O2S — CID 168613115
benzyl N'-[(2-methoxy-5-phenylmethoxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168613115) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is benzyl N'-[(2-methoxy-5-phenylmethoxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(2-methoxy-5-phenylmethoxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613115 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | benzyl N'-[(2-methoxy-5-phenylmethoxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | COc1ccc(OCc2ccccc2)cc1C=NN=C(N)SCc1ccccc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-27-22-13-12-21(28-16-18-8-4-2-5-9-18)14-20(22)15-25-26-23(24)29-17-19-10-6-3-7-11-19/h2-15H,16-17H2,1H3,(H2,24,26) |
| InChIKey | MOBMTNCBHQNLQF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|