C24H25N3O3S — CID 168612259
benzyl N'-[[3-methoxy-2-[(3-methoxyphenyl)methoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612259) has the molecular formula C24H25N3O3S and a molecular weight of 435.55 g/mol. Its IUPAC name is benzyl N'-[[3-methoxy-2-[(3-methoxyphenyl)methoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-methoxy-2-[(3-methoxyphenyl)methoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612259 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | benzyl N'-[[3-methoxy-2-[(3-methoxyphenyl)methoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1cccc(COc2c(C=NN=C(N)SCc3ccccc3)cccc2OC)c1 |
| InChI | InChI=1S/C24H25N3O3S/c1-28-21-12-6-10-19(14-21)16-30-23-20(11-7-13-22(23)29-2)15-26-27-24(25)31-17-18-8-4-3-5-9-18/h3-15H,16-17H2,1-2H3,(H2,25,27) |
| InChIKey | WYBKDZQIFNFSLD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|