C21H25N3O4S — CID 168612866
benzyl N'-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate (PubChem CID 168612866) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is benzyl N'-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612866 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | benzyl N'-[[2-[2-(1,3-dioxolan-2-yl)ethoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1cccc(C=NN=C(N)SCc2ccccc2)c1OCCC1OCCO1 |
| InChI | InChI=1S/C21H25N3O4S/c1-25-18-9-5-8-17(20(18)28-11-10-19-26-12-13-27-19)14-23-24-21(22)29-15-16-6-3-2-4-7-16/h2-9,14,19H,10-13,15H2,1H3,(H2,22,24) |
| InChIKey | TVYREHBFXBPDNG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|