C24H25N3OS — CID 168613638
benzyl N'-[[2-(4-propan-2-ylphenoxy)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613638) has the molecular formula C24H25N3OS and a molecular weight of 403.55 g/mol. Its IUPAC name is benzyl N'-[[2-(4-propan-2-ylphenoxy)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[2-(4-propan-2-ylphenoxy)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613638 |
| Molecular Formula | C24H25N3OS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | benzyl N'-[[2-(4-propan-2-ylphenoxy)phenyl]methylideneamino]carbamimidothioate |
| SMILES | CC(C)c1ccc(Oc2ccccc2C=NN=C(N)SCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25N3OS/c1-18(2)20-12-14-22(15-13-20)28-23-11-7-6-10-21(23)16-26-27-24(25)29-17-19-8-4-3-5-9-19/h3-16,18H,17H2,1-2H3,(H2,25,27) |
| InChIKey | QZEBSWAXOQVJQI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|