C15H15N3OS — CID 172938914
benzyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 172938914) has the molecular formula C15H15N3OS and a molecular weight of 285.37 g/mol. Its IUPAC name is benzyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 172938914 |
| Molecular Formula | C15H15N3OS |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | benzyl N'-[(2-hydroxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | N/C(=N/N=Cc1ccccc1O)SCc1ccccc1 |
| InChI | InChI=1S/C15H15N3OS/c16-15(20-11-12-6-2-1-3-7-12)18-17-10-13-8-4-5-9-14(13)19/h1-10,19H,11H2,(H2,16,18) |
| InChIKey | GAZLVEWWBRFNON-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|