C15H13F2N3O2S — CID 168612501
benzyl N'-[(3,5-difluoro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168612501) has the molecular formula C15H13F2N3O2S and a molecular weight of 337.35 g/mol. Its IUPAC name is benzyl N'-[(3,5-difluoro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(3,5-difluoro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612501 |
| Molecular Formula | C15H13F2N3O2S |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | benzyl N'-[(3,5-difluoro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(F)c(O)c(F)c1O)SCc1ccccc1 |
| InChI | InChI=1S/C15H13F2N3O2S/c16-11-6-10(13(21)12(17)14(11)22)7-19-20-15(18)23-8-9-4-2-1-3-5-9/h1-7,21-22H,8H2,(H2,18,20) |
| InChIKey | AXFKQDDRWHMTFK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|