C15H14BrN3OS — CID 168600608
benzyl N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168600608) has the molecular formula C15H14BrN3OS and a molecular weight of 364.27 g/mol. Its IUPAC name is benzyl N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168600608 |
| Molecular Formula | C15H14BrN3OS |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | benzyl N'-[(5-bromo-2-hydroxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(Br)ccc1O)SCc1ccccc1 |
| InChI | InChI=1S/C15H14BrN3OS/c16-13-6-7-14(20)12(8-13)9-18-19-15(17)21-10-11-4-2-1-3-5-11/h1-9,20H,10H2,(H2,17,19) |
| InChIKey | RXYBMUZGKYNMBU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|