C17H18BrN3S — CID 168613776
benzyl N'-[(4-bromo-2,3-dimethylphenyl)methylideneamino]carbamimidothioate (PubChem CID 168613776) has the molecular formula C17H18BrN3S and a molecular weight of 376.32 g/mol. Its IUPAC name is benzyl N'-[(4-bromo-2,3-dimethylphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(4-bromo-2,3-dimethylphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613776 |
| Molecular Formula | C17H18BrN3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | benzyl N'-[(4-bromo-2,3-dimethylphenyl)methylideneamino]carbamimidothioate |
| SMILES | Cc1c(Br)ccc(C=NN=C(N)SCc2ccccc2)c1C |
| InChI | InChI=1S/C17H18BrN3S/c1-12-13(2)16(18)9-8-15(12)10-20-21-17(19)22-11-14-6-4-3-5-7-14/h3-10H,11H2,1-2H3,(H2,19,21) |
| InChIKey | AVMKXPSFYMWYDV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|