C17H18BrN3OS — CID 168611861
benzyl N'-[(5-bromo-2-hydroxy-3,6-dimethylphenyl)methylideneamino]carbamimidothioate (PubChem CID 168611861) has the molecular formula C17H18BrN3OS and a molecular weight of 392.32 g/mol. Its IUPAC name is benzyl N'-[(5-bromo-2-hydroxy-3,6-dimethylphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(5-bromo-2-hydroxy-3,6-dimethylphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611861 |
| Molecular Formula | C17H18BrN3OS |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | benzyl N'-[(5-bromo-2-hydroxy-3,6-dimethylphenyl)methylideneamino]carbamimidothioate |
| SMILES | Cc1cc(Br)c(C)c(C=NN=C(N)SCc2ccccc2)c1O |
| InChI | InChI=1S/C17H18BrN3OS/c1-11-8-15(18)12(2)14(16(11)22)9-20-21-17(19)23-10-13-6-4-3-5-7-13/h3-9,22H,10H2,1-2H3,(H2,19,21) |
| InChIKey | RYFBLAKBRZWKHO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|