C17H19N3OS — CID 168611829
benzyl N'-[(2-hydroxy-4,5-dimethylphenyl)methylideneamino]carbamimidothioate (PubChem CID 168611829) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is benzyl N'-[(2-hydroxy-4,5-dimethylphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(2-hydroxy-4,5-dimethylphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611829 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | benzyl N'-[(2-hydroxy-4,5-dimethylphenyl)methylideneamino]carbamimidothioate |
| SMILES | Cc1cc(O)c(C=NN=C(N)SCc2ccccc2)cc1C |
| InChI | InChI=1S/C17H19N3OS/c1-12-8-15(16(21)9-13(12)2)10-19-20-17(18)22-11-14-6-4-3-5-7-14/h3-10,21H,11H2,1-2H3,(H2,18,20) |
| InChIKey | MJBWAENYGZBPOV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|