C15H13BrClN3S — CID 168610994
benzyl N'-[(3-bromo-4-chlorophenyl)methylideneamino]carbamimidothioate (PubChem CID 168610994) has the molecular formula C15H13BrClN3S and a molecular weight of 382.71 g/mol. Its IUPAC name is benzyl N'-[(3-bromo-4-chlorophenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(3-bromo-4-chlorophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168610994 |
| Molecular Formula | C15H13BrClN3S |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | benzyl N'-[(3-bromo-4-chlorophenyl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1ccc(Cl)c(Br)c1)SCc1ccccc1 |
| InChI | InChI=1S/C15H13BrClN3S/c16-13-8-12(6-7-14(13)17)9-19-20-15(18)21-10-11-4-2-1-3-5-11/h1-9H,10H2,(H2,18,20) |
| InChIKey | JFSDLSDQQQQKSG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|