C17H16BrN3OS — CID 168612115
benzyl N'-[(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]carbamimidothioate (PubChem CID 168612115) has the molecular formula C17H16BrN3OS and a molecular weight of 390.31 g/mol. Its IUPAC name is benzyl N'-[(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612115 |
| Molecular Formula | C17H16BrN3OS |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | benzyl N'-[(7-bromo-2,3-dihydro-1-benzofuran-5-yl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(Br)c2c(c1)CCO2)SCc1ccccc1 |
| InChI | InChI=1S/C17H16BrN3OS/c18-15-9-13(8-14-6-7-22-16(14)15)10-20-21-17(19)23-11-12-4-2-1-3-5-12/h1-5,8-10H,6-7,11H2,(H2,19,21) |
| InChIKey | STXXUJVUJVJMKW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|