C16H14ClN3O2S — CID 168612046
benzyl N'-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]carbamimidothioate (PubChem CID 168612046) has the molecular formula C16H14ClN3O2S and a molecular weight of 347.83 g/mol. Its IUPAC name is benzyl N'-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612046 |
| Molecular Formula | C16H14ClN3O2S |
| Molecular Weight | 347.83 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | benzyl N'-[(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]carbamimidothioate |
| SMILES | NC(=NN=Cc1cc(Cl)c2c(c1)OCO2)SCc1ccccc1 |
| InChI | InChI=1S/C16H14ClN3O2S/c17-13-6-12(7-14-15(13)22-10-21-14)8-19-20-16(18)23-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H2,18,20) |
| InChIKey | VSJDKVVNCROWCG-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.83 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|