C23H20ClN3O3S — CID 168612917
[4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-chloro-6-methoxyphenyl] benzoate (PubChem CID 168612917) has the molecular formula C23H20ClN3O3S and a molecular weight of 453.95 g/mol. Its IUPAC name is [4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-chloro-6-methoxyphenyl] benzoate.
| Compound Name | [4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-chloro-6-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 168612917 |
| Molecular Formula | C23H20ClN3O3S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | [4-[[[amino(benzylsulfanyl)methylidene]hydrazinylidene]methyl]-2-chloro-6-methoxyphenyl] benzoate |
| SMILES | COc1cc(C=NN=C(N)SCc2ccccc2)cc(Cl)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H20ClN3O3S/c1-29-20-13-17(14-26-27-23(25)31-15-16-8-4-2-5-9-16)12-19(24)21(20)30-22(28)18-10-6-3-7-11-18/h2-14H,15H2,1H3,(H2,25,27) |
| InChIKey | VHFKIUUXLDILLY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|