C20H24ClN3O2S — CID 168612403
benzyl N'-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168612403) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is benzyl N'-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612403 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | benzyl N'-[(4-butan-2-yloxy-3-chloro-5-methoxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | CCC(C)Oc1c(Cl)cc(C=NN=C(N)SCc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H24ClN3O2S/c1-4-14(2)26-19-17(21)10-16(11-18(19)25-3)12-23-24-20(22)27-13-15-8-6-5-7-9-15/h5-12,14H,4,13H2,1-3H3,(H2,22,24) |
| InChIKey | KLLRWQWYYAGWMW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|