C23H23N3OS2 — CID 168611930
benzyl N'-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylideneamino]carbamimidothioate (PubChem CID 168611930) has the molecular formula C23H23N3OS2 and a molecular weight of 421.59 g/mol. Its IUPAC name is benzyl N'-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168611930 |
| Molecular Formula | C23H23N3OS2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | benzyl N'-[[3-methoxy-4-(phenylsulfanylmethyl)phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1cc(C=NN=C(N)SCc2ccccc2)ccc1CSc1ccccc1 |
| InChI | InChI=1S/C23H23N3OS2/c1-27-22-14-19(12-13-20(22)17-28-21-10-6-3-7-11-21)15-25-26-23(24)29-16-18-8-4-2-5-9-18/h2-15H,16-17H2,1H3,(H2,24,26) |
| InChIKey | QZLNCUHDHRMYCT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|