C20H22N4O2S — CID 168612568
benzyl N'-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylideneamino]carbamimidothioate (PubChem CID 168612568) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is benzyl N'-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612568 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | benzyl N'-[[3-(3-cyanopropoxy)-4-methoxyphenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1ccc(C=NN=C(N)SCc2ccccc2)cc1OCCCC#N |
| InChI | InChI=1S/C20H22N4O2S/c1-25-18-10-9-17(13-19(18)26-12-6-5-11-21)14-23-24-20(22)27-15-16-7-3-2-4-8-16/h2-4,7-10,13-14H,5-6,12,15H2,1H3,(H2,22,24) |
| InChIKey | WDKALUHTLQBSSY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|