C18H21N3O2S — CID 168610950
benzyl N'-[(3-ethoxy-4-methoxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 168610950) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is benzyl N'-[(3-ethoxy-4-methoxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[(3-ethoxy-4-methoxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168610950 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | benzyl N'-[(3-ethoxy-4-methoxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | CCOc1cc(C=NN=C(N)SCc2ccccc2)ccc1OC |
| InChI | InChI=1S/C18H21N3O2S/c1-3-23-17-11-15(9-10-16(17)22-2)12-20-21-18(19)24-13-14-7-5-4-6-8-14/h4-12H,3,13H2,1-2H3,(H2,19,21) |
| InChIKey | IJUMPWOLXKURRA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|