C26H28N4O3S — CID 168612911
benzyl N'-[[4-[2-(benzylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]carbamimidothioate (PubChem CID 168612911) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is benzyl N'-[[4-[2-(benzylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[4-[2-(benzylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612911 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | benzyl N'-[[4-[2-(benzylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylideneamino]carbamimidothioate |
| SMILES | CCOc1cc(C=NN=C(N)SCc2ccccc2)ccc1OCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H28N4O3S/c1-2-32-24-15-22(17-29-30-26(27)34-19-21-11-7-4-8-12-21)13-14-23(24)33-18-25(31)28-16-20-9-5-3-6-10-20/h3-15,17H,2,16,18-19H2,1H3,(H2,27,30)(H,28,31) |
| InChIKey | HRYBYDKIOZYOIT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|