C28H26N4O3S — CID 168612910
benzyl N'-[[3-methoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168612910) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is benzyl N'-[[3-methoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[3-methoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168612910 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | benzyl N'-[[3-methoxy-4-[2-(naphthalen-1-ylamino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1cc(C=NN=C(N)SCc2ccccc2)ccc1OCC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C28H26N4O3S/c1-34-26-16-21(17-30-32-28(29)36-19-20-8-3-2-4-9-20)14-15-25(26)35-18-27(33)31-24-13-7-11-22-10-5-6-12-23(22)24/h2-17H,18-19H2,1H3,(H2,29,32)(H,31,33) |
| InChIKey | VEDPRUSFYQGAAK-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|