C24H23BrN4O3S — CID 168613022
benzyl N'-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate (PubChem CID 168613022) has the molecular formula C24H23BrN4O3S and a molecular weight of 527.44 g/mol. Its IUPAC name is benzyl N'-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate.
| Compound Name | benzyl N'-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 168613022 |
| Molecular Formula | C24H23BrN4O3S |
| Molecular Weight | 527.44 g/mol |
| Exact Mass | 526.07 |
| IUPAC Name | benzyl N'-[[5-bromo-2-[2-(2-methoxyanilino)-2-oxoethoxy]phenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1ccccc1NC(=O)COc1ccc(Br)cc1C=NN=C(N)SCc1ccccc1 |
| InChI | InChI=1S/C24H23BrN4O3S/c1-31-22-10-6-5-9-20(22)28-23(30)15-32-21-12-11-19(25)13-18(21)14-27-29-24(26)33-16-17-7-3-2-4-8-17/h2-14H,15-16H2,1H3,(H2,26,29)(H,28,30) |
| InChIKey | JDZOBYUKESJXPL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.44 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|