C24H22BrN3O5 — CID 126315510
N-[(E)-[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 126315510) has the molecular formula C24H22BrN3O5 and a molecular weight of 512.36 g/mol. Its IUPAC name is N-[(E)-[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-[(E)-[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 126315510 |
| Molecular Formula | C24H22BrN3O5 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | N-[(E)-[2-(2-amino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2cc(Br)ccc2OCC(N)=O)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H22BrN3O5/c1-31-22-12-17(7-9-21(22)32-14-16-5-3-2-4-6-16)24(30)28-27-13-18-11-19(25)8-10-20(18)33-15-23(26)29/h2-13H,14-15H2,1H3,(H2,26,29)(H,28,30)/b27-13+ |
| InChIKey | FZFIEEWIHUTAEQ-UVHMKAGCSA-N |
| XLogP | 3.66 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|