C23H20Br2N2O4 — CID 126328922
N-[(E)-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide (PubChem CID 126328922) has the molecular formula C23H20Br2N2O4 and a molecular weight of 548.23 g/mol. Its IUPAC name is N-[(E)-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 126328922 |
| Molecular Formula | C23H20Br2N2O4 |
| Molecular Weight | 548.23 g/mol |
| Exact Mass | 545.98 |
| IUPAC Name | N-[(E)-[5-bromo-2-[(4-bromophenyl)methoxy]phenyl]methylideneamino]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C/c2cc(Br)ccc2OCc2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C23H20Br2N2O4/c1-29-21-9-5-16(12-22(21)30-2)23(28)27-26-13-17-11-19(25)8-10-20(17)31-14-15-3-6-18(24)7-4-15/h3-13H,14H2,1-2H3,(H,27,28)/b26-13+ |
| InChIKey | LARNBNQWBNDLLA-LGJNPRDNSA-N |
| XLogP | 5.57 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.23 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|