C17H17BrN4O2S — CID 5454865
2-[4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 5454865) has the molecular formula C17H17BrN4O2S and a molecular weight of 421.32 g/mol. Its IUPAC name is 2-[4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 5454865 |
| Molecular Formula | C17H17BrN4O2S |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | 2-[4-bromo-2-[(Z)-(carbamothioylhydrazinylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1NC(=O)COc1ccc(Br)cc1/C=N\NC(N)=S |
| InChI | InChI=1S/C17H17BrN4O2S/c1-11-4-2-3-5-14(11)21-16(23)10-24-15-7-6-13(18)8-12(15)9-20-22-17(19)25/h2-9H,10H2,1H3,(H,21,23)(H3,19,22,25)/b20-9- |
| InChIKey | NSTUHQFIWAPWSX-UKWGHVSLSA-N |
| XLogP | 2.94 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|