C23H27BrN4O4 — CID 126161516
N'-[(Z)-[5-bromo-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-butyloxamide (PubChem CID 126161516) has the molecular formula C23H27BrN4O4 and a molecular weight of 503.40 g/mol. Its IUPAC name is N'-[(Z)-[5-bromo-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-butyloxamide.
| Compound Name | N'-[(Z)-[5-bromo-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-butyloxamide |
|---|---|
| PubChem CID | 126161516 |
| Molecular Formula | C23H27BrN4O4 |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | N'-[(Z)-[5-bromo-2-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]methylideneamino]-N-butyloxamide |
| SMILES | CCCCNC(=O)C(=O)N/N=C\c1cc(Br)ccc1OCC(=O)Nc1cc(C)ccc1C |
| InChI | InChI=1S/C23H27BrN4O4/c1-4-5-10-25-22(30)23(31)28-26-13-17-12-18(24)8-9-20(17)32-14-21(29)27-19-11-15(2)6-7-16(19)3/h6-9,11-13H,4-5,10,14H2,1-3H3,(H,25,30)(H,27,29)(H,28,31)/b26-13- |
| InChIKey | CPIDAMDXRFNGLT-ZMFRSBBQSA-N |
| XLogP | 3.45 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|