C19H19BrN4O4 — CID 126181829
N'-[(Z)-[2-(2-anilino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-N-ethyloxamide (PubChem CID 126181829) has the molecular formula C19H19BrN4O4 and a molecular weight of 447.29 g/mol. Its IUPAC name is N'-[(Z)-[2-(2-anilino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-N-ethyloxamide.
| Compound Name | N'-[(Z)-[2-(2-anilino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-N-ethyloxamide |
|---|---|
| PubChem CID | 126181829 |
| Molecular Formula | C19H19BrN4O4 |
| Molecular Weight | 447.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | N'-[(Z)-[2-(2-anilino-2-oxoethoxy)-5-bromophenyl]methylideneamino]-N-ethyloxamide |
| SMILES | CCNC(=O)C(=O)N/N=C\c1cc(Br)ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C19H19BrN4O4/c1-2-21-18(26)19(27)24-22-11-13-10-14(20)8-9-16(13)28-12-17(25)23-15-6-4-3-5-7-15/h3-11H,2,12H2,1H3,(H,21,26)(H,23,25)(H,24,27)/b22-11- |
| InChIKey | SMSKSLRFFXZTEG-JJFYIABZSA-N |
| XLogP | 2.05 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|